plzhelpmeasap46 plzhelpmeasap46

03-06-2019
Chemistry

contestada

Balance the following equations:

CuS2 + HNO3 →

Cu(NO3)2 + H2SO4 +

N2O + ___H20

Respuesta :

dcrim1972 dcrim1972

03-06-2019

Answer:

50CuS2 + 260HNO3 = 50Cu(NO3)2 + 100H2SO4 + 80N2O + 3H2O

Explanation:

Answer Link

Otras preguntas

HELP Which statement best describes the shaded region in the Venn diagram?

PLZ ANSWER NOW What is the value of the expression (2.3 × 107)(1.4 × 10−2) written in scientific notation?

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Which vocabulary word best completes the following sentence? The excitement of the revolution ____ people, and they demanded freedoms they had never before dare

The essential purpose of president kennedy's promise to land a man on the moon by the end of the 1960s was to

BRAINLY! A glass of water at 10 °C was kept in the open. After 10 minutes, the water became warmer. Which statement is correct? A The temperature of the surrou

Which four parts of this conversation between two classmates indicate Frank's goals? JAMIE: Frank, since you’re heading off to college in a month, what do you p

Which type of poetry does Wesley use when she creates her own structure?

How does the melting ice cap affect the extraction of oil, natural gas and minerals

Which of the following serve as ways to overcome subjective influences on perception? Select all that apply. seeking clarification from others attributing some