weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

The ________ refers to the underlying genetic structure that leads to the observ-able ________.

Literary Focus: Irony Which of the following is a characteristic of situational irony? a. the reader is kept in the dark b. the outcome of a situation is th

What does SIP stand for?

Help I truly don’t understand anything

A number divided by four and the quotient is added to three .the result is 24 what is the number?

How do the roots of most plants obtain food for survival? A)They store food within them. B)The phloem tissue carries food to the roots. C)They survive by abs

A molecule with polar and nonpolar parts that only partially dissolves in water is described as __________.

Burning does the following A) Takes up oxygen B) Produces oxygen C) Does both

Which of these helps qualify Beowulf as an epic poem? A:It reflects a Christian influence*** B:Its protagonist is a god-like hero C:It contains pagan reference

Medina is looking at the historical period in which smaller groupings of humans developed into much larger societies, often ruled by kings, queens, and emperors