adpresc adpresc
  • 01-05-2022
  • Mathematics
contestada


19. The product of two consecutive integers is 5 more than three times the larger

Respuesta :

ariannacxu ariannacxu
  • 01-05-2022
x = larger number
x-1 = smaller number

x*(x-1)=5+3x

x^2-4x-5=0 use the formula

x=5
x-1=4
the 2 numbers are 5&4 or -1,-2


Answer Link

Otras preguntas

Because he was well aware of the effect his theory of evolution would have on the public and on the Church of England, Darwin delayed publishing his work for se
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Which geometric figure has 120 rotational symmetry?
A projectile is able to orbit the Earth at what speed?
What is the Theme of Determining big Dreams
How is everyone coping with the pandemic?
who had been a bitter critic of the Congress and Gandhi accusing them for the upliftment of Scheduled Castes?
7/13 + 1/5 (its in fractions)
Why is graphite slippery when pressed? Select one: a. covalent bonds break b. hexagonal layers slide c. molecules of graphite slide
He songs better than he plays